C28H31ClN4O4S — CID 17318077
N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 17318077) has the molecular formula C28H31ClN4O4S and a molecular weight of 555.10 g/mol. Its IUPAC name is N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17318077 |
| Molecular Formula | C28H31ClN4O4S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(N3CCN(Cc4ccccc4Cl)CC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H31ClN4O4S/c1-35-24-16-20(17-25(36-2)26(24)37-3)27(34)31-28(38)30-21-8-10-22(11-9-21)33-14-12-32(13-15-33)18-19-6-4-5-7-23(19)29/h4-11,16-17H,12-15,18H2,1-3H3,(H2,30,31,34,38) |
| InChIKey | PNKJKFPHBNCBDN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|