C25H24BrClN4OS — CID 17318072
4-bromo-N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17318072) has the molecular formula C25H24BrClN4OS and a molecular weight of 543.92 g/mol. Its IUPAC name is 4-bromo-N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17318072 |
| Molecular Formula | C25H24BrClN4OS |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 4-bromo-N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H24BrClN4OS/c26-20-7-5-18(6-8-20)24(32)29-25(33)28-21-9-11-22(12-10-21)31-15-13-30(14-16-31)17-19-3-1-2-4-23(19)27/h1-12H,13-17H2,(H2,28,29,32,33) |
| InChIKey | DPZQCPYFZCMLHB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|