C25H26ClFN3O+ — CID 2213937
3-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenyl]-4-methylbenzamide (PubChem CID 2213937) has the molecular formula C25H26ClFN3O+ and a molecular weight of 438.95 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 2213937 |
| Molecular Formula | C25H26ClFN3O+ |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-chloro-N-[4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CC[NH+](Cc4ccccc4F)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C25H25ClFN3O/c1-18-6-7-19(16-23(18)26)25(31)28-21-8-10-22(11-9-21)30-14-12-29(13-15-30)17-20-4-2-3-5-24(20)27/h2-11,16H,12-15,17H2,1H3,(H,28,31)/p+1 |
| InChIKey | BDDFVXJILJQYCK-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|