C18H19FN2O2 — CID 28801028
4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]benzoate (PubChem CID 28801028) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]benzoate.
| Compound Name | 4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]benzoate |
|---|---|
| PubChem CID | 28801028 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2CC[NH+](Cc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C18H19FN2O2/c19-17-4-2-1-3-15(17)13-20-9-11-21(12-10-20)16-7-5-14(6-8-16)18(22)23/h1-8H,9-13H2,(H,22,23) |
| InChIKey | WQIRBOHJTAEWBP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |