C25H26FN2O+ — CID 4754589
1-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2,2-diphenylethanone (PubChem CID 4754589) has the molecular formula C25H26FN2O+ and a molecular weight of 389.49 g/mol. Its IUPAC name is 1-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 4754589 |
| Molecular Formula | C25H26FN2O+ |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-[4-[(2-fluorophenyl)methyl]piperazin-4-ium-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CC[NH+](Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C25H25FN2O/c26-23-14-8-7-13-22(23)19-27-15-17-28(18-16-27)25(29)24(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-14,24H,15-19H2/p+1 |
| InChIKey | OFHJEBHZDOGHPZ-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |