C29H29N2O+ — CID 4754444
1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone (PubChem CID 4754444) has the molecular formula C29H29N2O+ and a molecular weight of 421.56 g/mol. Its IUPAC name is 1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 4754444 |
| Molecular Formula | C29H29N2O+ |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C29H28N2O/c32-29(28(24-11-3-1-4-12-24)25-13-5-2-6-14-25)31-20-18-30(19-21-31)22-26-16-9-15-23-10-7-8-17-27(23)26/h1-17,28H,18-22H2/p+1 |
| InChIKey | HYQAGGXMGFDKAK-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |