C22H28N3OS2+ — CID 8694493
[2-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 8694493) has the molecular formula C22H28N3OS2+ and a molecular weight of 414.62 g/mol. Its IUPAC name is [2-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8694493 |
| Molecular Formula | C22H28N3OS2+ |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [2-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)N1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C22H27N3OS2/c26-21(17-28-22(27)25-10-3-4-11-25)24-14-12-23(13-15-24)16-19-8-5-7-18-6-1-2-9-20(18)19/h1-2,5-9H,3-4,10-17H2/p+1 |
| InChIKey | HWNAWYDHMHKRRH-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|