C20H28N3S2+ — CID 9097510
N-(3-methylsulfanylpropyl)-4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 9097510) has the molecular formula C20H28N3S2+ and a molecular weight of 374.60 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3-methylsulfanylpropyl)-4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9097510 |
| Molecular Formula | C20H28N3S2+ |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | CSCCCNC(=S)N1CC[NH+](Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C20H27N3S2/c1-25-15-5-10-21-20(24)23-13-11-22(12-14-23)16-18-8-4-7-17-6-2-3-9-19(17)18/h2-4,6-9H,5,10-16H2,1H3,(H,21,24)/p+1 |
| InChIKey | XICWTNRQSIQVOY-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|