C16H24ClN3S2 — CID 8660266
4-(5-chloro-2-methylphenyl)-N-(3-methylsulfanylpropyl)piperazine-1-carbothioamide (PubChem CID 8660266) has the molecular formula C16H24ClN3S2 and a molecular weight of 357.98 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-(3-methylsulfanylpropyl)piperazine-1-carbothioamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-(3-methylsulfanylpropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8660266 |
| Molecular Formula | C16H24ClN3S2 |
| Molecular Weight | 357.98 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-(3-methylsulfanylpropyl)piperazine-1-carbothioamide |
| SMILES | CSCCCNC(=S)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C16H24ClN3S2/c1-13-4-5-14(17)12-15(13)19-7-9-20(10-8-19)16(21)18-6-3-11-22-2/h4-5,12H,3,6-11H2,1-2H3,(H,18,21) |
| InChIKey | LMQQHAGFLZVKQZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.98 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|