C16H25ClN4S — CID 2472217
4-(5-chloro-2-methylphenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide (PubChem CID 2472217) has the molecular formula C16H25ClN4S and a molecular weight of 340.92 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2472217 |
| Molecular Formula | C16H25ClN4S |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=S)NCCN(C)C)CC1 |
| InChI | InChI=1S/C16H25ClN4S/c1-13-4-5-14(17)12-15(13)20-8-10-21(11-9-20)16(22)18-6-7-19(2)3/h4-5,12H,6-11H2,1-3H3,(H,18,22) |
| InChIKey | LZKYADGKJIINDL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|