C16H26N4OS — CID 8681550
N-[2-(dimethylamino)ethyl]-4-(3-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 8681550) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(3-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(3-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8681550 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(3-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1cccc(N2CCN(C(=S)NCCN(C)C)CC2)c1 |
| InChI | InChI=1S/C16H26N4OS/c1-18(2)8-7-17-16(22)20-11-9-19(10-12-20)14-5-4-6-15(13-14)21-3/h4-6,13H,7-12H2,1-3H3,(H,17,22) |
| InChIKey | WUVJJAANWZBJDB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|