C16H25N3S — CID 115575040
N-butyl-4-(3-methylphenyl)piperazine-1-carbothioamide (PubChem CID 115575040) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N-butyl-4-(3-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-butyl-4-(3-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 115575040 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-butyl-4-(3-methylphenyl)piperazine-1-carbothioamide |
| SMILES | CCCCNC(=S)N1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C16H25N3S/c1-3-4-8-17-16(20)19-11-9-18(10-12-19)15-7-5-6-14(2)13-15/h5-7,13H,3-4,8-12H2,1-2H3,(H,17,20) |
| InChIKey | HDKWZUFXSCCIKO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|