C21H33N7 — CID 111421335
N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methylphenyl)piperazine-1-carboximidamide (PubChem CID 111421335) has the molecular formula C21H33N7 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methylphenyl)piperazine-1-carboximidamide.
| Compound Name | N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methylphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111421335 |
| Molecular Formula | C21H33N7 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methylphenyl)piperazine-1-carboximidamide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)N1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C21H33N7/c1-5-6-10-22-21(23-16-20-25-24-18(3)26(20)4)28-13-11-27(12-14-28)19-9-7-8-17(2)15-19/h7-9,15H,5-6,10-14,16H2,1-4H3,(H,22,23) |
| InChIKey | GCOIVKVZNJHDML-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|