C21H33IN6S — CID 111749089
N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111749089) has the molecular formula C21H33IN6S and a molecular weight of 528.51 g/mol. Its IUPAC name is N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111749089 |
| Molecular Formula | C21H33IN6S |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C21H32N6S.HI/c1-4-5-12-22-21(23-14-20-25-24-17(2)26(20)3)27-13-11-18(15-27)16-28-19-9-7-6-8-10-19;/h6-10,18H,4-5,11-16H2,1-3H3,(H,22,23);1H |
| InChIKey | FUUXHACTTYYIDU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|