C23H28N6S — CID 111748894
N-ethyl-3-(phenylsulfanylmethyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111748894) has the molecular formula C23H28N6S and a molecular weight of 420.59 g/mol. Its IUPAC name is N-ethyl-3-(phenylsulfanylmethyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(phenylsulfanylmethyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748894 |
| Molecular Formula | C23H28N6S |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-ethyl-3-(phenylsulfanylmethyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N6S/c1-2-24-23(25-15-22-27-26-18-29(22)20-9-5-3-6-10-20)28-14-13-19(16-28)17-30-21-11-7-4-8-12-21/h3-12,18-19H,2,13-17H2,1H3,(H,24,25) |
| InChIKey | FFIUFUAEPWVKEB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|