C21H35IN4OS — CID 111748737
N-[2-[[ethylamino-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111748737) has the molecular formula C21H35IN4OS and a molecular weight of 518.51 g/mol. Its IUPAC name is N-[2-[[ethylamino-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111748737 |
| Molecular Formula | C21H35IN4OS |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[2-[[ethylamino-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C21H34N4OS.HI/c1-5-22-20(24-13-12-23-19(26)21(2,3)4)25-14-11-17(15-25)16-27-18-9-7-6-8-10-18;/h6-10,17H,5,11-16H2,1-4H3,(H,22,24)(H,23,26);1H |
| InChIKey | UFKYGPQNUZJYHS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|