C23H29N5S — CID 111749204
N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111749204) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111749204 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nc2ccccc2[nH]1)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C23H29N5S/c1-2-24-23(25-14-12-22-26-20-10-6-7-11-21(20)27-22)28-15-13-18(16-28)17-29-19-8-4-3-5-9-19/h3-11,18H,2,12-17H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | WCKXBPABJPAJCM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|