C21H34N4OS — CID 111749335
N-ethyl-N'-(3-morpholin-4-ylpropyl)-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111749335) has the molecular formula C21H34N4OS and a molecular weight of 390.60 g/mol. Its IUPAC name is N-ethyl-N'-(3-morpholin-4-ylpropyl)-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(3-morpholin-4-ylpropyl)-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111749335 |
| Molecular Formula | C21H34N4OS |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N-ethyl-N'-(3-morpholin-4-ylpropyl)-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCOCC1)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C21H34N4OS/c1-2-22-21(23-10-6-11-24-13-15-26-16-14-24)25-12-9-19(17-25)18-27-20-7-4-3-5-8-20/h3-5,7-8,19H,2,6,9-18H2,1H3,(H,22,23) |
| InChIKey | RRWWBEWAIKWRLH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|