C23H40IN5S — CID 111749400
N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111749400) has the molecular formula C23H40IN5S and a molecular weight of 545.58 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111749400 |
| Molecular Formula | C23H40IN5S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN1CCN(CCCCN/C(=N\C)N2CCC(CSc3ccccc3)C2)CC1.I |
| InChI | InChI=1S/C23H39N5S.HI/c1-3-26-15-17-27(18-16-26)13-8-7-12-25-23(24-2)28-14-11-21(19-28)20-29-22-9-5-4-6-10-22;/h4-6,9-10,21H,3,7-8,11-20H2,1-2H3,(H,24,25);1H |
| InChIKey | FJCFKTWCOUFJSJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|