C19H31N3OS — CID 111749529
N-(4-ethoxybutyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111749529) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is N-(4-ethoxybutyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-(4-ethoxybutyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111749529 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-(4-ethoxybutyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCOCCCCN/C(=N\C)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C19H31N3OS/c1-3-23-14-8-7-12-21-19(20-2)22-13-11-17(15-22)16-24-18-9-5-4-6-10-18/h4-6,9-10,17H,3,7-8,11-16H2,1-2H3,(H,20,21) |
| InChIKey | DJVOZFZRMGKXOI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|