C18H27N3S2 — CID 111749150
N'-methyl-3-(phenylsulfanylmethyl)-N-(2-prop-2-enylsulfanylethyl)pyrrolidine-1-carboximidamide (PubChem CID 111749150) has the molecular formula C18H27N3S2 and a molecular weight of 349.57 g/mol. Its IUPAC name is N'-methyl-3-(phenylsulfanylmethyl)-N-(2-prop-2-enylsulfanylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(phenylsulfanylmethyl)-N-(2-prop-2-enylsulfanylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111749150 |
| Molecular Formula | C18H27N3S2 |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N'-methyl-3-(phenylsulfanylmethyl)-N-(2-prop-2-enylsulfanylethyl)pyrrolidine-1-carboximidamide |
| SMILES | C=CCSCCN/C(=N\C)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3S2/c1-3-12-22-13-10-20-18(19-2)21-11-9-16(14-21)15-23-17-7-5-4-6-8-17/h3-8,16H,1,9-15H2,2H3,(H,19,20) |
| InChIKey | APMRFAZYBVEKDU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|