C16H23BrIN3S — CID 119145442
N-(2-bromoprop-2-enyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119145442) has the molecular formula C16H23BrIN3S and a molecular weight of 496.26 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(2-bromoprop-2-enyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119145442 |
| Molecular Formula | C16H23BrIN3S |
| Molecular Weight | 496.26 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C=C(Br)CN/C(=N\C)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C16H22BrN3S.HI/c1-13(17)10-19-16(18-2)20-9-8-14(11-20)12-21-15-6-4-3-5-7-15;/h3-7,14H,1,8-12H2,2H3,(H,18,19);1H |
| InChIKey | HMCMJJBVZVLLLO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|