C18H29IN4O2S — CID 111748791
N-(2-methoxyethyl)-2-[[N-methyl-C-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide (PubChem CID 111748791) has the molecular formula C18H29IN4O2S and a molecular weight of 492.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N-methyl-C-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(2-methoxyethyl)-2-[[N-methyl-C-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111748791 |
| Molecular Formula | C18H29IN4O2S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N-methyl-C-[3-(phenylsulfanylmethyl)pyrrolidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCOC)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C18H28N4O2S.HI/c1-19-18(21-12-17(23)20-9-11-24-2)22-10-8-15(13-22)14-25-16-6-4-3-5-7-16;/h3-7,15H,8-14H2,1-2H3,(H,19,21)(H,20,23);1H |
| InChIKey | QQCZPOUVSXJQKE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|