C21H36N4S — CID 111749023
N-[4-(diethylamino)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111749023) has the molecular formula C21H36N4S and a molecular weight of 376.61 g/mol. Its IUPAC name is N-[4-(diethylamino)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[4-(diethylamino)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111749023 |
| Molecular Formula | C21H36N4S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-[4-(diethylamino)butyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN(CC)CCCCN/C(=N\C)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C21H36N4S/c1-4-24(5-2)15-10-9-14-23-21(22-3)25-16-13-19(17-25)18-26-20-11-7-6-8-12-20/h6-8,11-12,19H,4-5,9-10,13-18H2,1-3H3,(H,22,23) |
| InChIKey | WQBWYFRFSIXHPZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|