C22H38N4 — CID 111152434
4-benzyl-N-[4-(diethylamino)butyl]-N'-methylpiperidine-1-carboximidamide (PubChem CID 111152434) has the molecular formula C22H38N4 and a molecular weight of 358.57 g/mol. Its IUPAC name is 4-benzyl-N-[4-(diethylamino)butyl]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[4-(diethylamino)butyl]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111152434 |
| Molecular Formula | C22H38N4 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | 4-benzyl-N-[4-(diethylamino)butyl]-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCN(CC)CCCCN/C(=N\C)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H38N4/c1-4-25(5-2)16-10-9-15-24-22(23-3)26-17-13-21(14-18-26)19-20-11-7-6-8-12-20/h6-8,11-12,21H,4-5,9-10,13-19H2,1-3H3,(H,23,24) |
| InChIKey | MXLPAKKBAPMRPK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|