C22H37IN4O — CID 111152499
4-benzyl-N'-methyl-N-(4-morpholin-4-ylbutyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 111152499) has the molecular formula C22H37IN4O and a molecular weight of 500.47 g/mol. Its IUPAC name is 4-benzyl-N'-methyl-N-(4-morpholin-4-ylbutyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N'-methyl-N-(4-morpholin-4-ylbutyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111152499 |
| Molecular Formula | C22H37IN4O |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-benzyl-N'-methyl-N-(4-morpholin-4-ylbutyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCN1CCOCC1)N1CCC(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H36N4O.HI/c1-23-22(24-11-5-6-12-25-15-17-27-18-16-25)26-13-9-21(10-14-26)19-20-7-3-2-4-8-20;/h2-4,7-8,21H,5-6,9-19H2,1H3,(H,23,24);1H |
| InChIKey | WFKBVURQMYUKQM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|