C20H32IN5O2 — CID 111747053
N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111747053) has the molecular formula C20H32IN5O2 and a molecular weight of 501.41 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111747053 |
| Molecular Formula | C20H32IN5O2 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-yl)ethyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc2ccccc2[nH]1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C20H31N5O2.HI/c1-3-21-20(25-11-9-16(14-25)15-27-13-12-26-2)22-10-8-19-23-17-6-4-5-7-18(17)24-19;/h4-7,16H,3,8-15H2,1-2H3,(H,21,22)(H,23,24);1H |
| InChIKey | LKBSXZLXOBZKCT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|