C20H31N5O2 — CID 111746443
N-[3-(1H-benzimidazol-2-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111746443) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111746443 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2[nH]1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C20H31N5O2/c1-21-20(25-11-9-16(14-25)15-27-13-12-26-2)22-10-5-8-19-23-17-6-3-4-7-18(17)24-19/h3-4,6-7,16H,5,8-15H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | XXNVIHJKTATQQE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|