C19H28N6 — CID 111154067
N-ethyl-3,5-dimethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111154067) has the molecular formula C19H28N6 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-3,5-dimethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111154067 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N-ethyl-3,5-dimethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C19H28N6/c1-4-20-19(24-12-15(2)10-16(3)13-24)21-11-18-23-22-14-25(18)17-8-6-5-7-9-17/h5-9,14-16H,4,10-13H2,1-3H3,(H,20,21) |
| InChIKey | MOXLMTVCKCLPII-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|