C20H30N6OS — CID 109437999
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 109437999) has the molecular formula C20H30N6OS and a molecular weight of 402.57 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109437999 |
| Molecular Formula | C20H30N6OS |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H30N6OS/c1-3-21-20(24-16-9-8-12-18(13-16)28(27)4-2)22-14-19-25-23-15-26(19)17-10-6-5-7-11-17/h5-7,10-11,15-16,18H,3-4,8-9,12-14H2,1-2H3,(H2,21,22,24) |
| InChIKey | PFTPIVTWHPMASQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|