C21H30N4O2S — CID 109439833
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine (PubChem CID 109439833) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109439833 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(5-phenyl-1,3-oxazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)o1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C21H30N4O2S/c1-3-22-21(25-17-11-8-12-18(13-17)28(26)4-2)24-15-20-23-14-19(27-20)16-9-6-5-7-10-16/h5-7,9-10,14,17-18H,3-4,8,11-13,15H2,1-2H3,(H2,22,24,25) |
| InChIKey | OYQODBACIKLPGW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|