C17H30N6OS — CID 109437951
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109437951) has the molecular formula C17H30N6OS and a molecular weight of 366.54 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109437951 |
| Molecular Formula | C17H30N6OS |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C17H30N6OS/c1-3-18-17(19-12-16-22-21-15-9-6-10-23(15)16)20-13-7-5-8-14(11-13)25(24)4-2/h13-14H,3-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | NFJAICYZCJQUJD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|