C20H40N4OS — CID 109438543
1-ethyl-2-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109438543) has the molecular formula C20H40N4OS and a molecular weight of 384.63 g/mol. Its IUPAC name is 1-ethyl-2-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109438543 |
| Molecular Formula | C20H40N4OS |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 1-ethyl-2-[2-(1-ethylpiperidin-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\CCC1CCN(CC)CC1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H40N4OS/c1-4-21-20(22-13-10-17-11-14-24(5-2)15-12-17)23-18-8-7-9-19(16-18)26(25)6-3/h17-19H,4-16H2,1-3H3,(H2,21,22,23) |
| InChIKey | OKFBAUFAEHNZBB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|