C16H32N4O3S2 — CID 109440999
2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109440999) has the molecular formula C16H32N4O3S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109440999 |
| Molecular Formula | C16H32N4O3S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C16H32N4O3S2/c1-3-17-16(18-9-11-20-10-6-12-25(20,22)23)19-14-7-5-8-15(13-14)24(21)4-2/h14-15H,3-13H2,1-2H3,(H2,17,18,19) |
| InChIKey | NRXOFDMBIZSKKU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|