C19H38N4OS — CID 109439197
1-ethyl-2-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109439197) has the molecular formula C19H38N4OS and a molecular weight of 370.61 g/mol. Its IUPAC name is 1-ethyl-2-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109439197 |
| Molecular Formula | C19H38N4OS |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | 1-ethyl-2-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\CC1CCCCN1CC)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C19H38N4OS/c1-4-20-19(21-15-17-11-7-8-13-23(17)5-2)22-16-10-9-12-18(14-16)25(24)6-3/h16-18H,4-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | UVCBVBILMXNZJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|