C15H21IN6O — CID 120661279
2-methyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661279) has the molecular formula C15H21IN6O and a molecular weight of 428.28 g/mol. Its IUPAC name is 2-methyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661279 |
| Molecular Formula | C15H21IN6O |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-methyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(/C(N)=N/Cc2nncn2-c2ccccc2)CCO1.I |
| InChI | InChI=1S/C15H20N6O.HI/c1-12-10-20(7-8-22-12)15(16)17-9-14-19-18-11-21(14)13-5-3-2-4-6-13;/h2-6,11-12H,7-10H2,1H3,(H2,16,17);1H |
| InChIKey | OJSYHMWKWNNPAO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|