About 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide
2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661263) has the molecular formula C11H20IN5O
and a molecular weight of 365.21 g/mol. Its IUPAC name is 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| PubChem CID | 120661263 |
| Molecular Formula | C11H20IN5O |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1CN(CCO1)C(=NCC2=CC=NN2C)N.I |
| InChI | InChI=1S/C11H19N5O.HI/c1-9-8-16(5-6-17-9)11(12)13-7-10-3-4-14-15(10)2;/h3-4,9H,5-8H2,1-2H3,(H2,12,13);1H |
| InChIKey | ZZTZXJJOBYYQEQ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 283 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide?
The IUPAC name of 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide (CID 120661263) is 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide?
The canonical SMILES for 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide is CC1CN(CCO1)C(=NCC2=CC=NN2C)N.I.
What is the InChIKey of 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide?
The InChIKey is ZZTZXJJOBYYQEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O.HI/c1-9-8-16(5-6-17-9)11(12)13-7-10-3-4-14-15(10)2;/h3-4,9H,5-8H2,1-2H3,(H2,12,13);1H.
What are the key properties of 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide?
2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide has a molecular weight of 365.21 g/mol, XLogP of not available, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-[(2-methylpyrazol-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide is sourced from PubChem (CID 120661263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).