C11H19IN4OS — CID 120661149
2-methyl-N'-[(4-methyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661149) has the molecular formula C11H19IN4OS and a molecular weight of 382.27 g/mol. Its IUPAC name is 2-methyl-N'-[(4-methyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[(4-methyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661149 |
| Molecular Formula | C11H19IN4OS |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-methyl-N'-[(4-methyl-1,3-thiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1csc(C/N=C(\N)N2CCOC(C)C2)n1.I |
| InChI | InChI=1S/C11H18N4OS.HI/c1-8-7-17-10(14-8)5-13-11(12)15-3-4-16-9(2)6-15;/h7,9H,3-6H2,1-2H3,(H2,12,13);1H |
| InChIKey | ZDOVVHMKNIRDGX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|