C17H30IN5OS — CID 120661665
2-methyl-N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120661665) has the molecular formula C17H30IN5OS and a molecular weight of 479.43 g/mol. Its IUPAC name is 2-methyl-N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661665 |
| Molecular Formula | C17H30IN5OS |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-methyl-N'-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1nc(CN2CCC(C/N=C(\N)N3CCOC(C)C3)CC2)cs1.I |
| InChI | InChI=1S/C17H29N5OS.HI/c1-13-10-22(7-8-23-13)17(18)19-9-15-3-5-21(6-4-15)11-16-12-24-14(2)20-16;/h12-13,15H,3-11H2,1-2H3,(H2,18,19);1H |
| InChIKey | DEABYAFDCLGPEC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|