C22H34IN5S — CID 111808189
1-(2,6-diethylphenyl)-2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111808189) has the molecular formula C22H34IN5S and a molecular weight of 527.52 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,6-diethylphenyl)-2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111808189 |
| Molecular Formula | C22H34IN5S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CC1CCN(Cc2csc(C)n2)CC1.I |
| InChI | InChI=1S/C22H33N5S.HI/c1-4-18-7-6-8-19(5-2)21(18)26-22(23)24-13-17-9-11-27(12-10-17)14-20-15-28-16(3)25-20;/h6-8,15,17H,4-5,9-14H2,1-3H3,(H3,23,24,26);1H |
| InChIKey | FJLGPHLVMQOSSN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|