C12H22IN5S — CID 111117688
2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111117688) has the molecular formula C12H22IN5S and a molecular weight of 395.31 g/mol. Its IUPAC name is 2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111117688 |
| Molecular Formula | C12H22IN5S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | Cc1nc(CN2CCC(CN=C(N)N)CC2)cs1.I |
| InChI | InChI=1S/C12H21N5S.HI/c1-9-16-11(8-18-9)7-17-4-2-10(3-5-17)6-15-12(13)14;/h8,10H,2-7H2,1H3,(H4,13,14,15);1H |
| InChIKey | YTNYTMHPAYPMCF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|