C11H20N2S — CID 143966374
ethane;2-methyl-4-(pyrrolidin-1-ylmethyl)-1,3-thiazole (PubChem CID 143966374) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is ethane;2-methyl-4-(pyrrolidin-1-ylmethyl)-1,3-thiazole.
| Compound Name | ethane;2-methyl-4-(pyrrolidin-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 143966374 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | ethane;2-methyl-4-(pyrrolidin-1-ylmethyl)-1,3-thiazole |
| SMILES | CC.Cc1nc(CN2CCCC2)cs1 |
| InChI | InChI=1S/C9H14N2S.C2H6/c1-8-10-9(7-12-8)6-11-4-2-3-5-11;1-2/h7H,2-6H2,1H3;1-2H3 |
| InChIKey | AOFJCFOXVOJSKJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |