C16H24N6S — CID 97405626
2-methyl-4-[[3-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole (PubChem CID 97405626) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-methyl-4-[[3-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[[3-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97405626 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-methyl-4-[[3-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole |
| SMILES | Cc1nc(CN2CCCn3c(CN4CCCC4)nnc3C2)cs1 |
| InChI | InChI=1S/C16H24N6S/c1-13-17-14(12-23-13)9-21-7-4-8-22-15(18-19-16(22)11-21)10-20-5-2-3-6-20/h12H,2-11H2,1H3 |
| InChIKey | OYGYIVNQOAGGQN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |