C21H31N5S — CID 111808206
2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine (PubChem CID 111808206) has the molecular formula C21H31N5S and a molecular weight of 385.58 g/mol. Its IUPAC name is 2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine.
| Compound Name | 2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine |
|---|---|
| PubChem CID | 111808206 |
| Molecular Formula | C21H31N5S |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine |
| SMILES | Cc1nc(CN2CCC(C/N=C(\N)Nc3cccc(C(C)C)c3)CC2)cs1 |
| InChI | InChI=1S/C21H31N5S/c1-15(2)18-5-4-6-19(11-18)25-21(22)23-12-17-7-9-26(10-8-17)13-20-14-27-16(3)24-20/h4-6,11,14-15,17H,7-10,12-13H2,1-3H3,(H3,22,23,25) |
| InChIKey | KKIGKAWKAMUTDJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|