C13H20N4OS — CID 120661882
N'-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-2-methylmorpholine-4-carboximidamide (PubChem CID 120661882) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is N'-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-2-methylmorpholine-4-carboximidamide.
| Compound Name | N'-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661882 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N'-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-2-methylmorpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/Cc2nc(C3CC3)cs2)CCO1 |
| InChI | InChI=1S/C13H20N4OS/c1-9-7-17(4-5-18-9)13(14)15-6-12-16-11(8-19-12)10-2-3-10/h8-10H,2-7H2,1H3,(H2,14,15) |
| InChIKey | OGMVIASJEBIWEK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|