C11H21IN6O — CID 120663185
N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide (PubChem CID 120663185) has the molecular formula C11H21IN6O and a molecular weight of 380.23 g/mol. Its IUPAC name is N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120663185 |
| Molecular Formula | C11H21IN6O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCn1ncnc1C/N=C(\N)N1CCOC(C)C1.I |
| InChI | InChI=1S/C11H20N6O.HI/c1-3-17-10(14-8-15-17)6-13-11(12)16-4-5-18-9(2)7-16;/h8-9H,3-7H2,1-2H3,(H2,12,13);1H |
| InChIKey | GEYCXUSUCZHUBN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|