C7H13N5 — CID 130723743
N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]ethanimidamide (PubChem CID 130723743) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]ethanimidamide.
| Compound Name | N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 130723743 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | N'-[(2-ethyl-1,2,4-triazol-3-yl)methyl]ethanimidamide |
| SMILES | CCn1ncnc1C/N=C(\C)N |
| InChI | InChI=1S/C7H13N5/c1-3-12-7(10-5-11-12)4-9-6(2)8/h5H,3-4H2,1-2H3,(H2,8,9) |
| InChIKey | WLNFKFOTFMHQJD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|