About 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine (PubChem CID 62694920) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine.
Analyze 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine?
The IUPAC name of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine (CID 62694920) is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine.
What is the SMILES notation for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine?
The canonical SMILES for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine is CCn1ncnc1Cn1cc(N)cn1.
What is the InChIKey of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine?
The InChIKey is BNOUKYWUEHCNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6/c1-2-14-8(10-6-12-14)5-13-4-7(9)3-11-13/h3-4,6H,2,5,9H2,1H3.
What are the key properties of 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine?
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine has a molecular weight of 192.23 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrazol-4-amine is sourced from PubChem (CID 62694920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).