About 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one
6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one (PubChem CID 116788353) has the molecular formula C9H12N6O
and a molecular weight of 220.24 g/mol. Its IUPAC name is 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one |
| PubChem CID | 116788353 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one |
| SMILES | CCn1ncnc1Cn1nc(N)ccc1=O |
| InChI | InChI=1S/C9H12N6O/c1-2-14-8(11-6-12-14)5-15-9(16)4-3-7(10)13-15/h3-4,6H,2,5H2,1H3,(H2,10,13) |
| InChIKey | JMFVSOKWUULYAJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
The IUPAC name of 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one (CID 116788353) is 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one.
What is the SMILES notation for 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
The canonical SMILES for 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one is CCn1ncnc1Cn1nc(N)ccc1=O.
What is the InChIKey of 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
The InChIKey is JMFVSOKWUULYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6O/c1-2-14-8(11-6-12-14)5-15-9(16)4-3-7(10)13-15/h3-4,6H,2,5H2,1H3,(H2,10,13).
What are the key properties of 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one has a molecular weight of 220.24 g/mol, XLogP of -0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one is sourced from PubChem (CID 116788353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).