C11H8BrF2N3O — CID 114166631
6-amino-2-[(3-bromo-2,6-difluorophenyl)methyl]pyridazin-3-one (PubChem CID 114166631) has the molecular formula C11H8BrF2N3O and a molecular weight of 316.11 g/mol. Its IUPAC name is 6-amino-2-[(3-bromo-2,6-difluorophenyl)methyl]pyridazin-3-one.
| Compound Name | 6-amino-2-[(3-bromo-2,6-difluorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114166631 |
| Molecular Formula | C11H8BrF2N3O |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 6-amino-2-[(3-bromo-2,6-difluorophenyl)methyl]pyridazin-3-one |
| SMILES | Nc1ccc(=O)n(Cc2c(F)ccc(Br)c2F)n1 |
| InChI | InChI=1S/C11H8BrF2N3O/c12-7-1-2-8(13)6(11(7)14)5-17-10(18)4-3-9(15)16-17/h1-4H,5H2,(H2,15,16) |
| InChIKey | KHZLUKQBEYEWHK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|